C21H14BrI2N3O4 — CID 17245257
2-bromo-N-[(E)-[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]benzamide (PubChem CID 17245257) has the molecular formula C21H14BrI2N3O4 and a molecular weight of 706.07 g/mol. Its IUPAC name is 2-bromo-N-[(E)-[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 2-bromo-N-[(E)-[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 17245257 |
| Molecular Formula | C21H14BrI2N3O4 |
| Molecular Weight | 706.07 g/mol |
| Exact Mass | 704.83 |
| IUPAC Name | 2-bromo-N-[(E)-[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1cc(I)c(OCc2ccc([N+](=O)[O-])cc2)c(I)c1)c1ccccc1Br |
| InChI | InChI=1S/C21H14BrI2N3O4/c22-17-4-2-1-3-16(17)21(28)26-25-11-14-9-18(23)20(19(24)10-14)31-12-13-5-7-15(8-6-13)27(29)30/h1-11H,12H2,(H,26,28)/b25-11+ |
| InChIKey | JDTUUYMGXGGRFE-OPEKNORGSA-N |
| XLogP | 5.91 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.07 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|