C22H17BrIN3O5 — CID 17245274
2-bromo-N-[(E)-[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]benzamide (PubChem CID 17245274) has the molecular formula C22H17BrIN3O5 and a molecular weight of 610.20 g/mol. Its IUPAC name is 2-bromo-N-[(E)-[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 2-bromo-N-[(E)-[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 17245274 |
| Molecular Formula | C22H17BrIN3O5 |
| Molecular Weight | 610.20 g/mol |
| Exact Mass | 608.94 |
| IUPAC Name | 2-bromo-N-[(E)-[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]benzamide |
| SMILES | COc1cc(/C=N/NC(=O)c2ccccc2Br)cc(I)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H17BrIN3O5/c1-31-20-11-15(12-25-26-22(28)17-4-2-3-5-18(17)23)10-19(24)21(20)32-13-14-6-8-16(9-7-14)27(29)30/h2-12H,13H2,1H3,(H,26,28)/b25-12+ |
| InChIKey | OQHIJELGDPRXOM-BRJLIKDPSA-N |
| XLogP | 5.31 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.20 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|