C18H16BrIN2O5 — CID 124537111
methyl 2-[4-[(Z)-[(2-bromobenzoyl)hydrazinylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate (PubChem CID 124537111) has the molecular formula C18H16BrIN2O5 and a molecular weight of 547.14 g/mol. Its IUPAC name is methyl 2-[4-[(Z)-[(2-bromobenzoyl)hydrazinylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate.
| Compound Name | methyl 2-[4-[(Z)-[(2-bromobenzoyl)hydrazinylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 124537111 |
| Molecular Formula | C18H16BrIN2O5 |
| Molecular Weight | 547.14 g/mol |
| Exact Mass | 545.93 |
| IUPAC Name | methyl 2-[4-[(Z)-[(2-bromobenzoyl)hydrazinylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate |
| SMILES | COC(=O)COc1c(I)cc(/C=N\NC(=O)c2ccccc2Br)cc1OC |
| InChI | InChI=1S/C18H16BrIN2O5/c1-25-15-8-11(7-14(20)17(15)27-10-16(23)26-2)9-21-22-18(24)12-5-3-4-6-13(12)19/h3-9H,10H2,1-2H3,(H,22,24)/b21-9- |
| InChIKey | PMEQDWOBODWCNG-NKVSQWTQSA-N |
| XLogP | 3.38 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.14 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|