C21H22BrN3O7 — CID 4689927
methyl 2-[2-bromo-6-methoxy-4-[[[2-[(2-methoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 4689927) has the molecular formula C21H22BrN3O7 and a molecular weight of 508.33 g/mol. Its IUPAC name is methyl 2-[2-bromo-6-methoxy-4-[[[2-[(2-methoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-bromo-6-methoxy-4-[[[2-[(2-methoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 4689927 |
| Molecular Formula | C21H22BrN3O7 |
| Molecular Weight | 508.33 g/mol |
| Exact Mass | 507.06 |
| IUPAC Name | methyl 2-[2-bromo-6-methoxy-4-[[[2-[(2-methoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1c(Br)cc(C=NNC(=O)CNC(=O)c2ccccc2OC)cc1OC |
| InChI | InChI=1S/C21H22BrN3O7/c1-29-16-7-5-4-6-14(16)21(28)23-11-18(26)25-24-10-13-8-15(22)20(17(9-13)30-2)32-12-19(27)31-3/h4-10H,11-12H2,1-3H3,(H,23,28)(H,25,26) |
| InChIKey | LASSSPGRIVYIFZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|