C19H20IN3O5 — CID 5020423
2-iodo-N-[2-oxo-2-[2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]ethyl]benzamide (PubChem CID 5020423) has the molecular formula C19H20IN3O5 and a molecular weight of 497.29 g/mol. Its IUPAC name is 2-iodo-N-[2-oxo-2-[2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]ethyl]benzamide.
| Compound Name | 2-iodo-N-[2-oxo-2-[2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]ethyl]benzamide |
|---|---|
| PubChem CID | 5020423 |
| Molecular Formula | C19H20IN3O5 |
| Molecular Weight | 497.29 g/mol |
| Exact Mass | 497.04 |
| IUPAC Name | 2-iodo-N-[2-oxo-2-[2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]ethyl]benzamide |
| SMILES | COc1cc(C=NNC(=O)CNC(=O)c2ccccc2I)cc(OC)c1OC |
| InChI | InChI=1S/C19H20IN3O5/c1-26-15-8-12(9-16(27-2)18(15)28-3)10-22-23-17(24)11-21-19(25)13-6-4-5-7-14(13)20/h4-10H,11H2,1-3H3,(H,21,25)(H,23,24) |
| InChIKey | ZJKRMJYUHUXFTO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.29 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|