C21H25N3O7 — CID 4692929
3,5-dimethoxy-N-[2-oxo-2-[2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]ethyl]benzamide (PubChem CID 4692929) has the molecular formula C21H25N3O7 and a molecular weight of 431.45 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[2-oxo-2-[2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]ethyl]benzamide.
| Compound Name | 3,5-dimethoxy-N-[2-oxo-2-[2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]ethyl]benzamide |
|---|---|
| PubChem CID | 4692929 |
| Molecular Formula | C21H25N3O7 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 3,5-dimethoxy-N-[2-oxo-2-[2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]ethyl]benzamide |
| SMILES | COc1cc(OC)cc(C(=O)NCC(=O)NN=Cc2cc(OC)c(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C21H25N3O7/c1-27-15-8-14(9-16(10-15)28-2)21(26)22-12-19(25)24-23-11-13-6-17(29-3)20(31-5)18(7-13)30-4/h6-11H,12H2,1-5H3,(H,22,26)(H,24,25) |
| InChIKey | KSWLCNYLUIYKKU-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 116.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|