C22H35N3O5 — CID 4207066
N-[2-oxo-2-[2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]ethyl]decanamide (PubChem CID 4207066) has the molecular formula C22H35N3O5 and a molecular weight of 421.54 g/mol. Its IUPAC name is N-[2-oxo-2-[2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]ethyl]decanamide.
| Compound Name | N-[2-oxo-2-[2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]ethyl]decanamide |
|---|---|
| PubChem CID | 4207066 |
| Molecular Formula | C22H35N3O5 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | N-[2-oxo-2-[2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]ethyl]decanamide |
| SMILES | CCCCCCCCCC(=O)NCC(=O)NN=Cc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C22H35N3O5/c1-5-6-7-8-9-10-11-12-20(26)23-16-21(27)25-24-15-17-13-18(28-2)22(30-4)19(14-17)29-3/h13-15H,5-12,16H2,1-4H3,(H,23,26)(H,25,27) |
| InChIKey | ICNQHXPEZZRIOC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|