C29H40N4O8 — CID 98542039
N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]-N'-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]nonanediamide (PubChem CID 98542039) has the molecular formula C29H40N4O8 and a molecular weight of 572.66 g/mol. Its IUPAC name is N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]-N'-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]nonanediamide.
| Compound Name | N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]-N'-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]nonanediamide |
|---|---|
| PubChem CID | 98542039 |
| Molecular Formula | C29H40N4O8 |
| Molecular Weight | 572.66 g/mol |
| Exact Mass | 572.28 |
| IUPAC Name | N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]-N'-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]nonanediamide |
| SMILES | COc1cc(/C=N\NC(=O)CCCCCCCC(=O)N/N=C/c2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C29H40N4O8/c1-36-22-14-20(15-23(37-2)28(22)40-5)18-30-32-26(34)12-10-8-7-9-11-13-27(35)33-31-19-21-16-24(38-3)29(41-6)25(17-21)39-4/h14-19H,7-13H2,1-6H3,(H,32,34)(H,33,35)/b30-18-,31-19+ |
| InChIKey | ITPIYIOQMVPDKO-LJHNCSMGSA-N |
| XLogP | 4.07 |
| TPSA | 138.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.66 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|