C26H32Br2N4O6 — CID 135607142
N,N'-bis[(E)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]decanediamide (PubChem CID 135607142) has the molecular formula C26H32Br2N4O6 and a molecular weight of 656.37 g/mol. Its IUPAC name is N,N'-bis[(E)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]decanediamide.
| Compound Name | N,N'-bis[(E)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]decanediamide |
|---|---|
| PubChem CID | 135607142 |
| Molecular Formula | C26H32Br2N4O6 |
| Molecular Weight | 656.37 g/mol |
| Exact Mass | 654.07 |
| IUPAC Name | N,N'-bis[(E)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]decanediamide |
| SMILES | COc1cc(/C=N/NC(=O)CCCCCCCCC(=O)N/N=C/c2cc(Br)c(O)c(OC)c2)cc(Br)c1O |
| InChI | InChI=1S/C26H32Br2N4O6/c1-37-21-13-17(11-19(27)25(21)35)15-29-31-23(33)9-7-5-3-4-6-8-10-24(34)32-30-16-18-12-20(28)26(36)22(14-18)38-2/h11-16,35-36H,3-10H2,1-2H3,(H,31,33)(H,32,34)/b29-15+,30-16+ |
| InChIKey | KBCVSJISGYALLY-CMNXJCJSSA-N |
| XLogP | 5.36 |
| TPSA | 141.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.37 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|