C19H20BrN3O5 — CID 135606237
N'-[(E)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-N-(2-methoxyphenyl)butanediamide (PubChem CID 135606237) has the molecular formula C19H20BrN3O5 and a molecular weight of 450.29 g/mol. Its IUPAC name is N'-[(E)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-N-(2-methoxyphenyl)butanediamide.
| Compound Name | N'-[(E)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-N-(2-methoxyphenyl)butanediamide |
|---|---|
| PubChem CID | 135606237 |
| Molecular Formula | C19H20BrN3O5 |
| Molecular Weight | 450.29 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | N'-[(E)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-N-(2-methoxyphenyl)butanediamide |
| SMILES | COc1ccccc1NC(=O)CCC(=O)N/N=C/c1cc(Br)c(O)c(OC)c1 |
| InChI | InChI=1S/C19H20BrN3O5/c1-27-15-6-4-3-5-14(15)22-17(24)7-8-18(25)23-21-11-12-9-13(20)19(26)16(10-12)28-2/h3-6,9-11,26H,7-8H2,1-2H3,(H,22,24)(H,23,25)/b21-11+ |
| InChIKey | WVKWMPMWIHDLHE-SRZZPIQSSA-N |
| XLogP | 3.04 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|