C26H34N4O8 — CID 6152520
N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]-N'-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]hexanediamide (PubChem CID 6152520) has the molecular formula C26H34N4O8 and a molecular weight of 530.58 g/mol. Its IUPAC name is N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]-N'-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]hexanediamide.
| Compound Name | N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]-N'-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]hexanediamide |
|---|---|
| PubChem CID | 6152520 |
| Molecular Formula | C26H34N4O8 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]-N'-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]hexanediamide |
| SMILES | COc1cc(/C=N\NC(=O)CCCCC(=O)N/N=C/c2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C26H34N4O8/c1-33-19-11-17(12-20(34-2)25(19)37-5)15-27-29-23(31)9-7-8-10-24(32)30-28-16-18-13-21(35-3)26(38-6)22(14-18)36-4/h11-16H,7-10H2,1-6H3,(H,29,31)(H,30,32)/b27-15-,28-16+ |
| InChIKey | UBORDEBYKPOPHE-XFPKHNAPSA-N |
| XLogP | 2.90 |
| TPSA | 138.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|