C19H20Br2N2O6 — CID 3980653
2-(2,6-dibromo-4-methoxyphenoxy)-N-[(3,4,5-trimethoxyphenyl)methylideneamino]acetamide (PubChem CID 3980653) has the molecular formula C19H20Br2N2O6 and a molecular weight of 532.19 g/mol. Its IUPAC name is 2-(2,6-dibromo-4-methoxyphenoxy)-N-[(3,4,5-trimethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(2,6-dibromo-4-methoxyphenoxy)-N-[(3,4,5-trimethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 3980653 |
| Molecular Formula | C19H20Br2N2O6 |
| Molecular Weight | 532.19 g/mol |
| Exact Mass | 529.97 |
| IUPAC Name | 2-(2,6-dibromo-4-methoxyphenoxy)-N-[(3,4,5-trimethoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1cc(Br)c(OCC(=O)NN=Cc2cc(OC)c(OC)c(OC)c2)c(Br)c1 |
| InChI | InChI=1S/C19H20Br2N2O6/c1-25-12-7-13(20)18(14(21)8-12)29-10-17(24)23-22-9-11-5-15(26-2)19(28-4)16(6-11)27-3/h5-9H,10H2,1-4H3,(H,23,24) |
| InChIKey | RKEBITLTHYPFJQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 87.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.19 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|