C17H16Br2N2O5 — CID 135717336
2-(2,6-dibromo-4-methoxyphenoxy)-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]acetamide (PubChem CID 135717336) has the molecular formula C17H16Br2N2O5 and a molecular weight of 488.13 g/mol. Its IUPAC name is 2-(2,6-dibromo-4-methoxyphenoxy)-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(2,6-dibromo-4-methoxyphenoxy)-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135717336 |
| Molecular Formula | C17H16Br2N2O5 |
| Molecular Weight | 488.13 g/mol |
| Exact Mass | 485.94 |
| IUPAC Name | 2-(2,6-dibromo-4-methoxyphenoxy)-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1cc(Br)c(OCC(=O)N/N=C/c2ccc(O)c(OC)c2)c(Br)c1 |
| InChI | InChI=1S/C17H16Br2N2O5/c1-24-11-6-12(18)17(13(19)7-11)26-9-16(23)21-20-8-10-3-4-14(22)15(5-10)25-2/h3-8,22H,9H2,1-2H3,(H,21,23)/b20-8+ |
| InChIKey | VNGLHEQQJFIMAM-DNTJNYDQSA-N |
| XLogP | 3.46 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.13 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|