C20H22N4O7 — CID 136503640
N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-2-[2-[(2Z)-2-[(4-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethoxy]acetamide (PubChem CID 136503640) has the molecular formula C20H22N4O7 and a molecular weight of 430.42 g/mol. Its IUPAC name is N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-2-[2-[(2Z)-2-[(4-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethoxy]acetamide.
| Compound Name | N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-2-[2-[(2Z)-2-[(4-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethoxy]acetamide |
|---|---|
| PubChem CID | 136503640 |
| Molecular Formula | C20H22N4O7 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-2-[2-[(2Z)-2-[(4-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethoxy]acetamide |
| SMILES | COc1cc(/C=N\NC(=O)COCC(=O)N/N=C/c2ccc(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C20H22N4O7/c1-29-17-7-13(3-5-15(17)25)9-21-23-19(27)11-31-12-20(28)24-22-10-14-4-6-16(26)18(8-14)30-2/h3-10,25-26H,11-12H2,1-2H3,(H,23,27)(H,24,28)/b21-9-,22-10+ |
| InChIKey | KTOZPTNDWAIAQN-CHQRTDLRSA-N |
| XLogP | 0.73 |
| TPSA | 151.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|