C17H18N4O5 — CID 135458974
1,3-bis[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]urea (PubChem CID 135458974) has the molecular formula C17H18N4O5 and a molecular weight of 358.35 g/mol. Its IUPAC name is 1,3-bis[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]urea.
| Compound Name | 1,3-bis[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 135458974 |
| Molecular Formula | C17H18N4O5 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 1,3-bis[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]urea |
| SMILES | COc1cc(/C=N/NC(=O)N/N=C/c2ccc(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C17H18N4O5/c1-25-15-7-11(3-5-13(15)22)9-18-20-17(24)21-19-10-12-4-6-14(23)16(8-12)26-2/h3-10,22-23H,1-2H3,(H2,20,21,24)/b18-9+,19-10+ |
| InChIKey | IGJOUGNKARVEMY-VNIJRHKQSA-N |
| XLogP | 1.78 |
| TPSA | 124.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|