C19H22N4O5 — CID 5355980
1-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]-3-[(3,4-dimethoxyphenyl)methylideneamino]urea (PubChem CID 5355980) has the molecular formula C19H22N4O5 and a molecular weight of 386.41 g/mol. Its IUPAC name is 1-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]-3-[(3,4-dimethoxyphenyl)methylideneamino]urea.
| Compound Name | 1-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]-3-[(3,4-dimethoxyphenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 5355980 |
| Molecular Formula | C19H22N4O5 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 1-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]-3-[(3,4-dimethoxyphenyl)methylideneamino]urea |
| SMILES | COc1ccc(C=NNC(=O)N/N=C\c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C19H22N4O5/c1-25-15-7-5-13(9-17(15)27-3)11-20-22-19(24)23-21-12-14-6-8-16(26-2)18(10-14)28-4/h5-12H,1-4H3,(H2,22,23,24)/b20-11-,21-12? |
| InChIKey | PMAPOQYCJXXVRO-AEGWVRQOSA-N |
| XLogP | 2.39 |
| TPSA | 102.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|