C28H32N6O6 — CID 3251278
1,2,3-tris[(3,4-dimethoxyphenyl)methylideneamino]guanidine (PubChem CID 3251278) has the molecular formula C28H32N6O6 and a molecular weight of 548.60 g/mol. Its IUPAC name is 1,2,3-tris[(3,4-dimethoxyphenyl)methylideneamino]guanidine.
| Compound Name | 1,2,3-tris[(3,4-dimethoxyphenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 3251278 |
| Molecular Formula | C28H32N6O6 |
| Molecular Weight | 548.60 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | 1,2,3-tris[(3,4-dimethoxyphenyl)methylideneamino]guanidine |
| SMILES | COc1ccc(C=NN=C(NN=Cc2ccc(OC)c(OC)c2)NN=Cc2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C28H32N6O6/c1-35-22-10-7-19(13-25(22)38-4)16-29-32-28(33-30-17-20-8-11-23(36-2)26(14-20)39-5)34-31-18-21-9-12-24(37-3)27(15-21)40-6/h7-18H,1-6H3,(H2,32,33,34) |
| InChIKey | ASXXBDJDWHSTKS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 128.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.60 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|