C23H28N4O6 — CID 6004946
N,N'-bis[(Z)-(4-ethoxy-3-methoxyphenyl)methylideneamino]propanediamide (PubChem CID 6004946) has the molecular formula C23H28N4O6 and a molecular weight of 456.50 g/mol. Its IUPAC name is N,N'-bis[(Z)-(4-ethoxy-3-methoxyphenyl)methylideneamino]propanediamide.
| Compound Name | N,N'-bis[(Z)-(4-ethoxy-3-methoxyphenyl)methylideneamino]propanediamide |
|---|---|
| PubChem CID | 6004946 |
| Molecular Formula | C23H28N4O6 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | N,N'-bis[(Z)-(4-ethoxy-3-methoxyphenyl)methylideneamino]propanediamide |
| SMILES | CCOc1ccc(/C=N\NC(=O)CC(=O)N/N=C\c2ccc(OCC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C23H28N4O6/c1-5-32-18-9-7-16(11-20(18)30-3)14-24-26-22(28)13-23(29)27-25-15-17-8-10-19(33-6-2)21(12-17)31-4/h7-12,14-15H,5-6,13H2,1-4H3,(H,26,28)(H,27,29)/b24-14-,25-15- |
| InChIKey | ZIAJQRWBYATAGE-MQDDAKQZSA-N |
| XLogP | 2.49 |
| TPSA | 119.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|