C21H26N4O7 — CID 92856854
1-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]-3-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]urea (PubChem CID 92856854) has the molecular formula C21H26N4O7 and a molecular weight of 446.46 g/mol. Its IUPAC name is 1-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]-3-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]urea.
| Compound Name | 1-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]-3-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 92856854 |
| Molecular Formula | C21H26N4O7 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 1-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]-3-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]urea |
| SMILES | COc1cc(/C=N\NC(=O)N/N=C/c2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C21H26N4O7/c1-27-15-7-13(8-16(28-2)19(15)31-5)11-22-24-21(26)25-23-12-14-9-17(29-3)20(32-6)18(10-14)30-4/h7-12H,1-6H3,(H2,24,25,26)/b22-11-,23-12+ |
| InChIKey | JSXHJCRNJNANRQ-NQRIEWMKSA-N |
| XLogP | 2.41 |
| TPSA | 121.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|