C31H28F2N4O5 — CID 51342273
1-[(Z)-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-3-[(E)-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]urea (PubChem CID 51342273) has the molecular formula C31H28F2N4O5 and a molecular weight of 574.58 g/mol. Its IUPAC name is 1-[(Z)-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-3-[(E)-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]urea.
| Compound Name | 1-[(Z)-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-3-[(E)-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 51342273 |
| Molecular Formula | C31H28F2N4O5 |
| Molecular Weight | 574.58 g/mol |
| Exact Mass | 574.20 |
| IUPAC Name | 1-[(Z)-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-3-[(E)-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]urea |
| SMILES | COc1cc(/C=N\NC(=O)N/N=C/c2ccc(OCc3ccc(F)cc3)c(OC)c2)ccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C31H28F2N4O5/c1-39-29-15-23(7-13-27(29)41-19-21-3-9-25(32)10-4-21)17-34-36-31(38)37-35-18-24-8-14-28(30(16-24)40-2)42-20-22-5-11-26(33)12-6-22/h3-18H,19-20H2,1-2H3,(H2,36,37,38)/b34-17-,35-18+ |
| InChIKey | IPCXHSAJXCEMQB-MGDMGSQXSA-N |
| XLogP | 5.81 |
| TPSA | 102.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.58 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|