C16H16FN3O2S — CID 168535028
[[3-[(4-fluorophenyl)methoxy]-4-methoxyphenyl]methylideneamino]thiourea (PubChem CID 168535028) has the molecular formula C16H16FN3O2S and a molecular weight of 333.39 g/mol. Its IUPAC name is [[3-[(4-fluorophenyl)methoxy]-4-methoxyphenyl]methylideneamino]thiourea.
| Compound Name | [[3-[(4-fluorophenyl)methoxy]-4-methoxyphenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 168535028 |
| Molecular Formula | C16H16FN3O2S |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | [[3-[(4-fluorophenyl)methoxy]-4-methoxyphenyl]methylideneamino]thiourea |
| SMILES | COc1ccc(C=NNC(N)=S)cc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C16H16FN3O2S/c1-21-14-7-4-12(9-19-20-16(18)23)8-15(14)22-10-11-2-5-13(17)6-3-11/h2-9H,10H2,1H3,(H3,18,20,23) |
| InChIKey | MFDDTDNYIWMTFW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|