C24H30Br2N2O4 — CID 136713947
2-[2,6-dibromo-4-(2,4,4-trimethylpentan-2-yl)phenoxy]-N-[(Z)-(4-hydroxy-3-methoxyphenyl)methylideneamino]acetamide (PubChem CID 136713947) has the molecular formula C24H30Br2N2O4 and a molecular weight of 570.32 g/mol. Its IUPAC name is 2-[2,6-dibromo-4-(2,4,4-trimethylpentan-2-yl)phenoxy]-N-[(Z)-(4-hydroxy-3-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[2,6-dibromo-4-(2,4,4-trimethylpentan-2-yl)phenoxy]-N-[(Z)-(4-hydroxy-3-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 136713947 |
| Molecular Formula | C24H30Br2N2O4 |
| Molecular Weight | 570.32 g/mol |
| Exact Mass | 568.06 |
| IUPAC Name | 2-[2,6-dibromo-4-(2,4,4-trimethylpentan-2-yl)phenoxy]-N-[(Z)-(4-hydroxy-3-methoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1cc(/C=N\NC(=O)COc2c(Br)cc(C(C)(C)CC(C)(C)C)cc2Br)ccc1O |
| InChI | InChI=1S/C24H30Br2N2O4/c1-23(2,3)14-24(4,5)16-10-17(25)22(18(26)11-16)32-13-21(30)28-27-12-15-7-8-19(29)20(9-15)31-6/h7-12,29H,13-14H2,1-6H3,(H,28,30)/b27-12- |
| InChIKey | KJHXJJBBJZTMNS-PPDIBHTLSA-N |
| XLogP | 6.17 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.32 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|