C31H44Br2N2O3 — CID 136800199
2-[2,6-dibromo-4-(2,4,4-trimethylpentan-2-yl)phenoxy]-N-[(Z)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 136800199) has the molecular formula C31H44Br2N2O3 and a molecular weight of 652.51 g/mol. Its IUPAC name is 2-[2,6-dibromo-4-(2,4,4-trimethylpentan-2-yl)phenoxy]-N-[(Z)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[2,6-dibromo-4-(2,4,4-trimethylpentan-2-yl)phenoxy]-N-[(Z)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 136800199 |
| Molecular Formula | C31H44Br2N2O3 |
| Molecular Weight | 652.51 g/mol |
| Exact Mass | 650.17 |
| IUPAC Name | 2-[2,6-dibromo-4-(2,4,4-trimethylpentan-2-yl)phenoxy]-N-[(Z)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | CC(C)(C)CC(C)(C)c1cc(Br)c(OCC(=O)N/N=C\c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)c(Br)c1 |
| InChI | InChI=1S/C31H44Br2N2O3/c1-28(2,3)18-31(10,11)20-14-23(32)27(24(33)15-20)38-17-25(36)35-34-16-19-12-21(29(4,5)6)26(37)22(13-19)30(7,8)9/h12-16,37H,17-18H2,1-11H3,(H,35,36)/b34-16- |
| InChIKey | SYXZEPKHAKTHNG-MJXLXAJKSA-N |
| XLogP | 8.76 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.51 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|