C23H27BrN4O6 — CID 3097122
2-[2-bromo-6-nitro-4-(2,4,4-trimethylpentan-2-yl)phenoxy]-N-[(3-nitrophenyl)methylideneamino]acetamide (PubChem CID 3097122) has the molecular formula C23H27BrN4O6 and a molecular weight of 535.40 g/mol. Its IUPAC name is 2-[2-bromo-6-nitro-4-(2,4,4-trimethylpentan-2-yl)phenoxy]-N-[(3-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-[2-bromo-6-nitro-4-(2,4,4-trimethylpentan-2-yl)phenoxy]-N-[(3-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 3097122 |
| Molecular Formula | C23H27BrN4O6 |
| Molecular Weight | 535.40 g/mol |
| Exact Mass | 534.11 |
| IUPAC Name | 2-[2-bromo-6-nitro-4-(2,4,4-trimethylpentan-2-yl)phenoxy]-N-[(3-nitrophenyl)methylideneamino]acetamide |
| SMILES | CC(C)(C)CC(C)(C)c1cc(Br)c(OCC(=O)NN=Cc2cccc([N+](=O)[O-])c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H27BrN4O6/c1-22(2,3)14-23(4,5)16-10-18(24)21(19(11-16)28(32)33)34-13-20(29)26-25-12-15-7-6-8-17(9-15)27(30)31/h6-12H,13-14H2,1-5H3,(H,26,29) |
| InChIKey | CBGVHQQBANNGCE-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 136.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.40 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|