C15H12IN3O4 — CID 5334791
2-(4-iodophenoxy)-N-[(E)-(3-nitrophenyl)methylideneamino]acetamide (PubChem CID 5334791) has the molecular formula C15H12IN3O4 and a molecular weight of 425.18 g/mol. Its IUPAC name is 2-(4-iodophenoxy)-N-[(E)-(3-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-(4-iodophenoxy)-N-[(E)-(3-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 5334791 |
| Molecular Formula | C15H12IN3O4 |
| Molecular Weight | 425.18 g/mol |
| Exact Mass | 424.99 |
| IUPAC Name | 2-(4-iodophenoxy)-N-[(E)-(3-nitrophenyl)methylideneamino]acetamide |
| SMILES | O=C(COc1ccc(I)cc1)N/N=C/c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H12IN3O4/c16-12-4-6-14(7-5-12)23-10-15(20)18-17-9-11-2-1-3-13(8-11)19(21)22/h1-9H,10H2,(H,18,20)/b17-9+ |
| InChIKey | HGJNOSYUQCQZGQ-RQZCQDPDSA-N |
| XLogP | 2.73 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.18 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|