C19H18N6O6 — CID 5380788
N-[(3-nitrophenyl)methylideneamino]-N'-[(Z)-(3-nitrophenyl)methylideneamino]pentanediamide (PubChem CID 5380788) has the molecular formula C19H18N6O6 and a molecular weight of 426.39 g/mol. Its IUPAC name is N-[(3-nitrophenyl)methylideneamino]-N'-[(Z)-(3-nitrophenyl)methylideneamino]pentanediamide.
| Compound Name | N-[(3-nitrophenyl)methylideneamino]-N'-[(Z)-(3-nitrophenyl)methylideneamino]pentanediamide |
|---|---|
| PubChem CID | 5380788 |
| Molecular Formula | C19H18N6O6 |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | N-[(3-nitrophenyl)methylideneamino]-N'-[(Z)-(3-nitrophenyl)methylideneamino]pentanediamide |
| SMILES | O=C(CCCC(=O)N/N=C\c1cccc([N+](=O)[O-])c1)NN=Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H18N6O6/c26-18(22-20-12-14-4-1-6-16(10-14)24(28)29)8-3-9-19(27)23-21-13-15-5-2-7-17(11-15)25(30)31/h1-2,4-7,10-13H,3,8-9H2,(H,22,26)(H,23,27)/b20-12-,21-13? |
| InChIKey | SQNZMWWARSPCIZ-ZEUDRYFUSA-N |
| XLogP | 2.27 |
| TPSA | 169.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|