C15H12N6O4S — CID 6280519
1,3-bis[(Z)-(3-nitrophenyl)methylideneamino]thiourea (PubChem CID 6280519) has the molecular formula C15H12N6O4S and a molecular weight of 372.37 g/mol. Its IUPAC name is 1,3-bis[(Z)-(3-nitrophenyl)methylideneamino]thiourea.
| Compound Name | 1,3-bis[(Z)-(3-nitrophenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 6280519 |
| Molecular Formula | C15H12N6O4S |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 1,3-bis[(Z)-(3-nitrophenyl)methylideneamino]thiourea |
| SMILES | O=[N+]([O-])c1cccc(/C=N\NC(=S)N/N=C\c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C15H12N6O4S/c22-20(23)13-5-1-3-11(7-13)9-16-18-15(26)19-17-10-12-4-2-6-14(8-12)21(24)25/h1-10H,(H2,18,19,26)/b16-9-,17-10- |
| InChIKey | OBVRGSYPWFPNQE-CQRYCMKKSA-N |
| XLogP | 2.34 |
| TPSA | 135.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|