C21H18N4O4 — CID 4596802
N-naphthalen-1-yl-N'-[(3-nitrophenyl)methylideneamino]butanediamide (PubChem CID 4596802) has the molecular formula C21H18N4O4 and a molecular weight of 390.40 g/mol. Its IUPAC name is N-naphthalen-1-yl-N'-[(3-nitrophenyl)methylideneamino]butanediamide.
| Compound Name | N-naphthalen-1-yl-N'-[(3-nitrophenyl)methylideneamino]butanediamide |
|---|---|
| PubChem CID | 4596802 |
| Molecular Formula | C21H18N4O4 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | N-naphthalen-1-yl-N'-[(3-nitrophenyl)methylideneamino]butanediamide |
| SMILES | O=C(CCC(=O)Nc1cccc2ccccc12)NN=Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H18N4O4/c26-20(23-19-10-4-7-16-6-1-2-9-18(16)19)11-12-21(27)24-22-14-15-5-3-8-17(13-15)25(28)29/h1-10,13-14H,11-12H2,(H,23,26)(H,24,27) |
| InChIKey | IASJVZCAVCLZBZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|