C24H31N3O4 — CID 3834510
3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-[(3-nitrophenyl)methylideneamino]propanamide (PubChem CID 3834510) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is 3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-[(3-nitrophenyl)methylideneamino]propanamide.
| Compound Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-[(3-nitrophenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 3834510 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-[(3-nitrophenyl)methylideneamino]propanamide |
| SMILES | CC(C)(C)c1cc(CCC(=O)NN=Cc2cccc([N+](=O)[O-])c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C24H31N3O4/c1-23(2,3)19-13-16(14-20(22(19)29)24(4,5)6)10-11-21(28)26-25-15-17-8-7-9-18(12-17)27(30)31/h7-9,12-15,29H,10-11H2,1-6H3,(H,26,28) |
| InChIKey | WPINILNZQJRSJI-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 104.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|