C27H31BrN2O2 — CID 5009478
2-(4-bromonaphthalen-1-yl)-N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 5009478) has the molecular formula C27H31BrN2O2 and a molecular weight of 495.46 g/mol. Its IUPAC name is 2-(4-bromonaphthalen-1-yl)-N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(4-bromonaphthalen-1-yl)-N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 5009478 |
| Molecular Formula | C27H31BrN2O2 |
| Molecular Weight | 495.46 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | 2-(4-bromonaphthalen-1-yl)-N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | CC(C)(C)c1cc(C=NNC(=O)Cc2ccc(Br)c3ccccc23)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C27H31BrN2O2/c1-26(2,3)21-13-17(14-22(25(21)32)27(4,5)6)16-29-30-24(31)15-18-11-12-23(28)20-10-8-7-9-19(18)20/h7-14,16,32H,15H2,1-6H3,(H,30,31) |
| InChIKey | SVVVELVMGQVLKR-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.46 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|