C23H17BrN2O2 — CID 136802210
2-(4-bromonaphthalen-1-yl)-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]acetamide (PubChem CID 136802210) has the molecular formula C23H17BrN2O2 and a molecular weight of 433.31 g/mol. Its IUPAC name is 2-(4-bromonaphthalen-1-yl)-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]acetamide.
| Compound Name | 2-(4-bromonaphthalen-1-yl)-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 136802210 |
| Molecular Formula | C23H17BrN2O2 |
| Molecular Weight | 433.31 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | 2-(4-bromonaphthalen-1-yl)-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]acetamide |
| SMILES | O=C(Cc1ccc(Br)c2ccccc12)N/N=C\c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C23H17BrN2O2/c24-21-11-9-16(18-7-3-4-8-19(18)21)13-23(28)26-25-14-20-17-6-2-1-5-15(17)10-12-22(20)27/h1-12,14,27H,13H2,(H,26,28)/b25-14- |
| InChIKey | UZGHCUUCYZZUMN-QFEZKATASA-N |
| XLogP | 5.15 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.31 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|