C20H17BrN2O3 — CID 4035780
2-(4-bromonaphthalen-1-yl)-N-[(2,4-dihydroxy-6-methylphenyl)methylideneamino]acetamide (PubChem CID 4035780) has the molecular formula C20H17BrN2O3 and a molecular weight of 413.27 g/mol. Its IUPAC name is 2-(4-bromonaphthalen-1-yl)-N-[(2,4-dihydroxy-6-methylphenyl)methylideneamino]acetamide.
| Compound Name | 2-(4-bromonaphthalen-1-yl)-N-[(2,4-dihydroxy-6-methylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 4035780 |
| Molecular Formula | C20H17BrN2O3 |
| Molecular Weight | 413.27 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | 2-(4-bromonaphthalen-1-yl)-N-[(2,4-dihydroxy-6-methylphenyl)methylideneamino]acetamide |
| SMILES | Cc1cc(O)cc(O)c1C=NNC(=O)Cc1ccc(Br)c2ccccc12 |
| InChI | InChI=1S/C20H17BrN2O3/c1-12-8-14(24)10-19(25)17(12)11-22-23-20(26)9-13-6-7-18(21)16-5-3-2-4-15(13)16/h2-8,10-11,24-25H,9H2,1H3,(H,23,26) |
| InChIKey | KBTWNOVOBLZOAR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.27 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|