C30H32Br2N2O5 — CID 4525505
[4-[[[2-[2,6-dibromo-4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetyl]hydrazinylidene]methyl]phenyl] 3-(furan-2-yl)prop-2-enoate (PubChem CID 4525505) has the molecular formula C30H32Br2N2O5 and a molecular weight of 660.40 g/mol. Its IUPAC name is [4-[[[2-[2,6-dibromo-4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetyl]hydrazinylidene]methyl]phenyl] 3-(furan-2-yl)prop-2-enoate.
| Compound Name | [4-[[[2-[2,6-dibromo-4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetyl]hydrazinylidene]methyl]phenyl] 3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 4525505 |
| Molecular Formula | C30H32Br2N2O5 |
| Molecular Weight | 660.40 g/mol |
| Exact Mass | 658.07 |
| IUPAC Name | [4-[[[2-[2,6-dibromo-4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetyl]hydrazinylidene]methyl]phenyl] 3-(furan-2-yl)prop-2-enoate |
| SMILES | CC(C)(C)CC(C)(C)c1cc(Br)c(OCC(=O)NN=Cc2ccc(OC(=O)C=Cc3ccco3)cc2)c(Br)c1 |
| InChI | InChI=1S/C30H32Br2N2O5/c1-29(2,3)19-30(4,5)21-15-24(31)28(25(32)16-21)38-18-26(35)34-33-17-20-8-10-23(11-9-20)39-27(36)13-12-22-7-6-14-37-22/h6-17H,18-19H2,1-5H3,(H,34,35) |
| InChIKey | JQIJEJQSDAMXRW-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.40 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|