C26H20N2O5 — CID 5446419
[4-[(Z)-[(2-naphthalen-2-yloxyacetyl)hydrazinylidene]methyl]phenyl] (E)-3-(furan-2-yl)prop-2-enoate (PubChem CID 5446419) has the molecular formula C26H20N2O5 and a molecular weight of 440.46 g/mol. Its IUPAC name is [4-[(Z)-[(2-naphthalen-2-yloxyacetyl)hydrazinylidene]methyl]phenyl] (E)-3-(furan-2-yl)prop-2-enoate.
| Compound Name | [4-[(Z)-[(2-naphthalen-2-yloxyacetyl)hydrazinylidene]methyl]phenyl] (E)-3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 5446419 |
| Molecular Formula | C26H20N2O5 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | [4-[(Z)-[(2-naphthalen-2-yloxyacetyl)hydrazinylidene]methyl]phenyl] (E)-3-(furan-2-yl)prop-2-enoate |
| SMILES | O=C(COc1ccc2ccccc2c1)N/N=C\c1ccc(OC(=O)/C=C/c2ccco2)cc1 |
| InChI | InChI=1S/C26H20N2O5/c29-25(18-32-24-12-9-20-4-1-2-5-21(20)16-24)28-27-17-19-7-10-23(11-8-19)33-26(30)14-13-22-6-3-15-31-22/h1-17H,18H2,(H,28,29)/b14-13+,27-17- |
| InChIKey | OARMTRCPUDWCOS-LDXKMCRWSA-N |
| XLogP | 4.58 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|