C22H17ClN2O5 — CID 3983448
[4-[[[2-(2-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-(furan-2-yl)prop-2-enoate (PubChem CID 3983448) has the molecular formula C22H17ClN2O5 and a molecular weight of 424.84 g/mol. Its IUPAC name is [4-[[[2-(2-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-(furan-2-yl)prop-2-enoate.
| Compound Name | [4-[[[2-(2-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 3983448 |
| Molecular Formula | C22H17ClN2O5 |
| Molecular Weight | 424.84 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | [4-[[[2-(2-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-(furan-2-yl)prop-2-enoate |
| SMILES | O=C(COc1ccccc1Cl)NN=Cc1ccc(OC(=O)C=Cc2ccco2)cc1 |
| InChI | InChI=1S/C22H17ClN2O5/c23-19-5-1-2-6-20(19)29-15-21(26)25-24-14-16-7-9-18(10-8-16)30-22(27)12-11-17-4-3-13-28-17/h1-14H,15H2,(H,25,26) |
| InChIKey | SFEADRKSKUGMKO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.84 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|