C23H29ClN2O3 — CID 135827922
2-(4-chlorophenoxy)-N-[(E)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 135827922) has the molecular formula C23H29ClN2O3 and a molecular weight of 416.95 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[(E)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[(E)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135827922 |
| Molecular Formula | C23H29ClN2O3 |
| Molecular Weight | 416.95 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[(E)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | CC(C)(C)c1cc(/C=N/NC(=O)COc2ccc(Cl)cc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C23H29ClN2O3/c1-22(2,3)18-11-15(12-19(21(18)28)23(4,5)6)13-25-26-20(27)14-29-17-9-7-16(24)8-10-17/h7-13,28H,14H2,1-6H3,(H,26,27)/b25-13+ |
| InChIKey | JGCUREHLMPXKBR-DHRITJCHSA-N |
| XLogP | 5.17 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.95 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|