C22H27ClN2O2 — CID 136767804
4-chloro-N-[(Z)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]benzamide (PubChem CID 136767804) has the molecular formula C22H27ClN2O2 and a molecular weight of 386.92 g/mol. Its IUPAC name is 4-chloro-N-[(Z)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-chloro-N-[(Z)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 136767804 |
| Molecular Formula | C22H27ClN2O2 |
| Molecular Weight | 386.92 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 4-chloro-N-[(Z)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]benzamide |
| SMILES | CC(C)(C)c1cc(/C=N\NC(=O)c2ccc(Cl)cc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C22H27ClN2O2/c1-21(2,3)17-11-14(12-18(19(17)26)22(4,5)6)13-24-25-20(27)15-7-9-16(23)10-8-15/h7-13,26H,1-6H3,(H,25,27)/b24-13- |
| InChIKey | XDBFKVJVKIHDDT-CFRMEGHHSA-N |
| XLogP | 5.40 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.92 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|