C28H33N3O2 — CID 3506052
3-anilino-N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]benzamide (PubChem CID 3506052) has the molecular formula C28H33N3O2 and a molecular weight of 443.59 g/mol. Its IUPAC name is 3-anilino-N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]benzamide.
| Compound Name | 3-anilino-N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 3506052 |
| Molecular Formula | C28H33N3O2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | 3-anilino-N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]benzamide |
| SMILES | CC(C)(C)c1cc(C=NNC(=O)c2cccc(Nc3ccccc3)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C28H33N3O2/c1-27(2,3)23-15-19(16-24(25(23)32)28(4,5)6)18-29-31-26(33)20-11-10-14-22(17-20)30-21-12-8-7-9-13-21/h7-18,30,32H,1-6H3,(H,31,33) |
| InChIKey | OGKTZKYRDRRVMZ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|