C26H32N2O — CID 14649918
4-(4-anilinoanilino)-2,6-ditert-butylphenol (PubChem CID 14649918) has the molecular formula C26H32N2O and a molecular weight of 388.56 g/mol. Its IUPAC name is 4-(4-anilinoanilino)-2,6-ditert-butylphenol.
| Compound Name | 4-(4-anilinoanilino)-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 14649918 |
| Molecular Formula | C26H32N2O |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | 4-(4-anilinoanilino)-2,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(Nc2ccc(Nc3ccccc3)cc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C26H32N2O/c1-25(2,3)22-16-21(17-23(24(22)29)26(4,5)6)28-20-14-12-19(13-15-20)27-18-10-8-7-9-11-18/h7-17,27-29H,1-6H3 |
| InChIKey | JYBKSEFSFBVMBH-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|