About 4-anilino-2,6-dimethylphenol
4-anilino-2,6-dimethylphenol (PubChem CID 25129480) has the molecular formula C14H15NO
and a molecular weight of 213.28 g/mol. Its IUPAC name is 4-anilino-2,6-dimethylphenol.
Molecular Properties
| Compound Name | 4-anilino-2,6-dimethylphenol |
| PubChem CID | 25129480 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 4-anilino-2,6-dimethylphenol |
| SMILES | Cc1cc(Nc2ccccc2)cc(C)c1O |
| InChI | InChI=1S/C14H15NO/c1-10-8-13(9-11(2)14(10)16)15-12-6-4-3-5-7-12/h3-9,15-16H,1-2H3 |
| InChIKey | ZWPWXRQAOFQHDJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-anilino-2,6-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-anilino-2,6-dimethylphenol?
The IUPAC name of 4-anilino-2,6-dimethylphenol (CID 25129480) is 4-anilino-2,6-dimethylphenol.
What is the SMILES notation for 4-anilino-2,6-dimethylphenol?
The canonical SMILES for 4-anilino-2,6-dimethylphenol is Cc1cc(Nc2ccccc2)cc(C)c1O.
What is the InChIKey of 4-anilino-2,6-dimethylphenol?
The InChIKey is ZWPWXRQAOFQHDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO/c1-10-8-13(9-11(2)14(10)16)15-12-6-4-3-5-7-12/h3-9,15-16H,1-2H3.
What are the key properties of 4-anilino-2,6-dimethylphenol?
4-anilino-2,6-dimethylphenol has a molecular weight of 213.28 g/mol, XLogP of 3.75, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-anilino-2,6-dimethylphenol is sourced from PubChem (CID 25129480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).