C14H15NO — CID 25129480
4-anilino-2,6-dimethylphenol (PubChem CID 25129480) has the molecular formula C14H15NO and a molecular weight of 213.28 g/mol. Its IUPAC name is 4-anilino-2,6-dimethylphenol.
| Compound Name | 4-anilino-2,6-dimethylphenol |
|---|---|
| PubChem CID | 25129480 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 4-anilino-2,6-dimethylphenol |
| SMILES | Cc1cc(Nc2ccccc2)cc(C)c1O |
| InChI | InChI=1S/C14H15NO/c1-10-8-13(9-11(2)14(10)16)15-12-6-4-3-5-7-12/h3-9,15-16H,1-2H3 |
| InChIKey | ZWPWXRQAOFQHDJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|