About azane;N-phenylaniline
azane;N-phenylaniline (PubChem CID 67074378) has the molecular formula C12H17N3
and a molecular weight of 203.29 g/mol. Its IUPAC name is azane;N-phenylaniline.
Molecular Properties
| Compound Name | azane;N-phenylaniline |
| PubChem CID | 67074378 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | azane;N-phenylaniline |
| SMILES | N.N.c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11N.2H3N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;;/h1-10,13H;2*1H3 |
| InChIKey | BOWKJPGJOVANJM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azane;N-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;N-phenylaniline?
The IUPAC name of azane;N-phenylaniline (CID 67074378) is azane;N-phenylaniline.
What is the SMILES notation for azane;N-phenylaniline?
The canonical SMILES for azane;N-phenylaniline is N.N.c1ccc(Nc2ccccc2)cc1.
What is the InChIKey of azane;N-phenylaniline?
The InChIKey is BOWKJPGJOVANJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N.2H3N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;;/h1-10,13H;2*1H3.
What are the key properties of azane;N-phenylaniline?
azane;N-phenylaniline has a molecular weight of 203.29 g/mol, XLogP of 3.75, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;N-phenylaniline is sourced from PubChem (CID 67074378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).