About hydrazine;N-phenylaniline
hydrazine;N-phenylaniline (PubChem CID 159755629) has the molecular formula C12H15N3
and a molecular weight of 201.27 g/mol. Its IUPAC name is hydrazine;N-phenylaniline.
Molecular Properties
| Compound Name | hydrazine;N-phenylaniline |
| PubChem CID | 159755629 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | hydrazine;N-phenylaniline |
| SMILES | NN.c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11N.H4N2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2/h1-10,13H;1-2H2 |
| InChIKey | NEFJYNHYLVYVKW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydrazine;N-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrazine;N-phenylaniline?
The IUPAC name of hydrazine;N-phenylaniline (CID 159755629) is hydrazine;N-phenylaniline.
What is the SMILES notation for hydrazine;N-phenylaniline?
The canonical SMILES for hydrazine;N-phenylaniline is NN.c1ccc(Nc2ccccc2)cc1.
What is the InChIKey of hydrazine;N-phenylaniline?
The InChIKey is NEFJYNHYLVYVKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N.H4N2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2/h1-10,13H;1-2H2.
What are the key properties of hydrazine;N-phenylaniline?
hydrazine;N-phenylaniline has a molecular weight of 201.27 g/mol, XLogP of 2.25, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazine;N-phenylaniline is sourced from PubChem (CID 159755629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).