About 1,2-diphenylhydrazine;hydrazine
1,2-diphenylhydrazine;hydrazine (PubChem CID 161098943) has the molecular formula C12H16N4
and a molecular weight of 216.29 g/mol. Its IUPAC name is 1,2-diphenylhydrazine;hydrazine.
Molecular Properties
| Compound Name | 1,2-diphenylhydrazine;hydrazine |
| PubChem CID | 161098943 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 1,2-diphenylhydrazine;hydrazine |
| SMILES | NN.c1ccc(NNc2ccccc2)cc1 |
| InChI | InChI=1S/C12H12N2.H4N2/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12;1-2/h1-10,13-14H;1-2H2 |
| InChIKey | UIEBLJNWBSWSQO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,2-diphenylhydrazine;hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diphenylhydrazine;hydrazine?
The IUPAC name of 1,2-diphenylhydrazine;hydrazine (CID 161098943) is 1,2-diphenylhydrazine;hydrazine.
What is the SMILES notation for 1,2-diphenylhydrazine;hydrazine?
The canonical SMILES for 1,2-diphenylhydrazine;hydrazine is NN.c1ccc(NNc2ccccc2)cc1.
What is the InChIKey of 1,2-diphenylhydrazine;hydrazine?
The InChIKey is UIEBLJNWBSWSQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2.H4N2/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12;1-2/h1-10,13-14H;1-2H2.
What are the key properties of 1,2-diphenylhydrazine;hydrazine?
1,2-diphenylhydrazine;hydrazine has a molecular weight of 216.29 g/mol, XLogP of 1.94, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diphenylhydrazine;hydrazine is sourced from PubChem (CID 161098943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).