About 1,2-diphenylhydrazine;hydrobromide
1,2-diphenylhydrazine;hydrobromide (PubChem CID 162337860) has the molecular formula C12H13BrN2
and a molecular weight of 265.15 g/mol. Its IUPAC name is 1,2-diphenylhydrazine;hydrobromide.
Molecular Properties
| Compound Name | 1,2-diphenylhydrazine;hydrobromide |
| PubChem CID | 162337860 |
| Molecular Formula | C12H13BrN2 |
| Molecular Weight | 265.15 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | 1,2-diphenylhydrazine;hydrobromide |
| SMILES | Br.c1ccc(NNc2ccccc2)cc1 |
| InChI | InChI=1S/C12H12N2.BrH/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12;/h1-10,13-14H;1H |
| InChIKey | SCJUZGAFSFIRNJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.15 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,2-diphenylhydrazine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diphenylhydrazine;hydrobromide?
The IUPAC name of 1,2-diphenylhydrazine;hydrobromide (CID 162337860) is 1,2-diphenylhydrazine;hydrobromide.
What is the SMILES notation for 1,2-diphenylhydrazine;hydrobromide?
The canonical SMILES for 1,2-diphenylhydrazine;hydrobromide is Br.c1ccc(NNc2ccccc2)cc1.
What is the InChIKey of 1,2-diphenylhydrazine;hydrobromide?
The InChIKey is SCJUZGAFSFIRNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2.BrH/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12;/h1-10,13-14H;1H.
What are the key properties of 1,2-diphenylhydrazine;hydrobromide?
1,2-diphenylhydrazine;hydrobromide has a molecular weight of 265.15 g/mol, XLogP of 3.70, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diphenylhydrazine;hydrobromide is sourced from PubChem (CID 162337860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).