C13H16N6O — CID 151828503
1,3-bis(2-phenylhydrazinyl)urea (PubChem CID 151828503) has the molecular formula C13H16N6O and a molecular weight of 272.31 g/mol. Its IUPAC name is 1,3-bis(2-phenylhydrazinyl)urea.
| Compound Name | 1,3-bis(2-phenylhydrazinyl)urea |
|---|---|
| PubChem CID | 151828503 |
| Molecular Formula | C13H16N6O |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 1,3-bis(2-phenylhydrazinyl)urea |
| SMILES | O=C(NNNc1ccccc1)NNNc1ccccc1 |
| InChI | InChI=1S/C13H16N6O/c20-13(16-18-14-11-7-3-1-4-8-11)17-19-15-12-9-5-2-6-10-12/h1-10,14-15,18-19H,(H2,16,17,20) |
| InChIKey | SEDMHJYPCCBSJB-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|