About 1-anilino-3-methylurea;ethane
1-anilino-3-methylurea;ethane (PubChem CID 143768639) has the molecular formula C10H17N3O
and a molecular weight of 195.27 g/mol. Its IUPAC name is 1-anilino-3-methylurea;ethane.
Molecular Properties
| Compound Name | 1-anilino-3-methylurea;ethane |
| PubChem CID | 143768639 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 1-anilino-3-methylurea;ethane |
| SMILES | CC.CNC(=O)NNc1ccccc1 |
| InChI | InChI=1S/C8H11N3O.C2H6/c1-9-8(12)11-10-7-5-3-2-4-6-7;1-2/h2-6,10H,1H3,(H2,9,11,12);1-2H3 |
| InChIKey | HQGCFYZUCYSCNV-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-anilino-3-methylurea;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-anilino-3-methylurea;ethane?
The IUPAC name of 1-anilino-3-methylurea;ethane (CID 143768639) is 1-anilino-3-methylurea;ethane.
What is the SMILES notation for 1-anilino-3-methylurea;ethane?
The canonical SMILES for 1-anilino-3-methylurea;ethane is CC.CNC(=O)NNc1ccccc1.
What is the InChIKey of 1-anilino-3-methylurea;ethane?
The InChIKey is HQGCFYZUCYSCNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O.C2H6/c1-9-8(12)11-10-7-5-3-2-4-6-7;1-2/h2-6,10H,1H3,(H2,9,11,12);1-2H3.
What are the key properties of 1-anilino-3-methylurea;ethane?
1-anilino-3-methylurea;ethane has a molecular weight of 195.27 g/mol, XLogP of 1.97, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-anilino-3-methylurea;ethane is sourced from PubChem (CID 143768639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).