C13H24N4O2 — CID 137356075
bis(1,3-dimethylurea);toluene (PubChem CID 137356075) has the molecular formula C13H24N4O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is bis(1,3-dimethylurea);toluene.
| Compound Name | bis(1,3-dimethylurea);toluene |
|---|---|
| PubChem CID | 137356075 |
| Molecular Formula | C13H24N4O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | bis(1,3-dimethylurea);toluene |
| SMILES | CNC(=O)NC.CNC(=O)NC.Cc1ccccc1 |
| InChI | InChI=1S/C7H8.2C3H8N2O/c1-7-5-3-2-4-6-7;2*1-4-3(6)5-2/h2-6H,1H3;2*1-2H3,(H2,4,5,6) |
| InChIKey | ZSQNWXGSUBTAJV-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |