About potassium;hydrogen carbonate;toluene
potassium;hydrogen carbonate;toluene (PubChem CID 174871430) has the molecular formula C8H9KO3
and a molecular weight of 192.25 g/mol. Its IUPAC name is potassium;hydrogen carbonate;toluene.
Molecular Properties
| Compound Name | potassium;hydrogen carbonate;toluene |
| PubChem CID | 174871430 |
| Molecular Formula | C8H9KO3 |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.02 |
| IUPAC Name | potassium;hydrogen carbonate;toluene |
| SMILES | Cc1ccccc1.O=C([O-])O.[K+] |
| InChI | InChI=1S/C7H8.CH2O3.K/c1-7-5-3-2-4-6-7;2-1(3)4;/h2-6H,1H3;(H2,2,3,4);/q;;+1/p-1 |
| InChIKey | HGXISYWPIUMHSF-UHFFFAOYSA-M |
| XLogP | -2.11 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze potassium;hydrogen carbonate;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydrogen carbonate;toluene?
The IUPAC name of potassium;hydrogen carbonate;toluene (CID 174871430) is potassium;hydrogen carbonate;toluene.
What is the SMILES notation for potassium;hydrogen carbonate;toluene?
The canonical SMILES for potassium;hydrogen carbonate;toluene is Cc1ccccc1.O=C([O-])O.[K+].
What is the InChIKey of potassium;hydrogen carbonate;toluene?
The InChIKey is HGXISYWPIUMHSF-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8.CH2O3.K/c1-7-5-3-2-4-6-7;2-1(3)4;/h2-6H,1H3;(H2,2,3,4);/q;;+1/p-1.
What are the key properties of potassium;hydrogen carbonate;toluene?
potassium;hydrogen carbonate;toluene has a molecular weight of 192.25 g/mol, XLogP of -2.11, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydrogen carbonate;toluene is sourced from PubChem (CID 174871430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).