C13H13O3S- — CID 174274545
bicyclo[2.2.0]hexa-1,3,5-triene;hydrogen sulfite;toluene (PubChem CID 174274545) has the molecular formula C13H13O3S- and a molecular weight of 249.31 g/mol. Its IUPAC name is bicyclo[2.2.0]hexa-1,3,5-triene;hydrogen sulfite;toluene.
| Compound Name | bicyclo[2.2.0]hexa-1,3,5-triene;hydrogen sulfite;toluene |
|---|---|
| PubChem CID | 174274545 |
| Molecular Formula | C13H13O3S- |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | bicyclo[2.2.0]hexa-1,3,5-triene;hydrogen sulfite;toluene |
| SMILES | Cc1ccccc1.O=S([O-])O.c1cc2ccc1-2 |
| InChI | InChI=1S/C7H8.C6H4.H2O3S/c1-7-5-3-2-4-6-7;1-2-6-4-3-5(1)6;1-4(2)3/h2-6H,1H3;1-4H;(H2,1,2,3)/p-1 |
| InChIKey | WFGMCEBHTVTTDJ-UHFFFAOYSA-M |
| XLogP | 3.00 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|