C21H20 — CID 123859615
1-(cyclodecapentaenyl)-5-methylcyclodeca-1,3,5,7,9-pentaene (PubChem CID 123859615) has the molecular formula C21H20 and a molecular weight of 272.39 g/mol. Its IUPAC name is 1-(cyclodecapentaenyl)-5-methylcyclodeca-1,3,5,7,9-pentaene.
| Compound Name | 1-(cyclodecapentaenyl)-5-methylcyclodeca-1,3,5,7,9-pentaene |
|---|---|
| PubChem CID | 123859615 |
| Molecular Formula | C21H20 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 1-(cyclodecapentaenyl)-5-methylcyclodeca-1,3,5,7,9-pentaene |
| SMILES | Cc1cccccc(-c2ccccccccc2)ccc1 |
| InChI | InChI=1S/C21H20/c1-19-13-8-7-11-17-21(18-12-14-19)20-15-9-5-3-2-4-6-10-16-20/h2-18H,1H3/b3-2-,4-2-,5-3-,6-4+,8-7-,9-5+,10-6+,11-7+,13-8-,14-12+,15-9+,16-10-,17-11+,18-12-,19-13-,19-14+,20-15+,20-16+,21-17+,21-18+ |
| InChIKey | ZPJQFKVFEVGQKF-WFFGWWBASA-N |
| XLogP | 5.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |